What salt is in aspirin?
Aspirin sodium
| PubChem CID | 23666729 |
|---|---|
| Molecular Formula | C9H7NaO4 |
| Synonyms | Aspirin sodium Sodium acetylsalicylate Sodium O-acetylsalicylate 493-53-8 UNII-E62HT5S2E9 More… |
| Molecular Weight | 202.14 |
| Parent Compound | CID 2244 (Aspirin) |
What is the chemical formula of aspirin?
C₉H₈O₄
Aspirin/Formula
What is the formula of sodium salicylate?
C7H5NaO3
Sodium salicylate/Formula
What is the molecular structure of C9H8O4?
Identification of Aspirin Chemical Compound
| Chemical Formula | C9H8O4 |
|---|---|
| Molecular Weight | 180.15742 g/mol |
| IUPAC Name | 2-(acetyloxy)benzoic acid |
| SMILES String | CC(=O)Oc1ccccc1C(O)=O |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
What’s the ingredients in aspirin?
Active Ingredients: In Each Tablet: Aspirin (324 Mg) (Nsaid). Inactive Ingredients: Carnauba Wax (May Contain This Ingredient), Corn Starch, Hypromellose, Powdered Cellulose, Triacetin.
What does Asa stand for aspirin?
ASA is short for acetylsalicylic acid, which is sold under names including Aspirin, Entrophen and Novasen.
What is the molecular shape of aspirin?
The structure of aspirin is: For C1 to C3 and C6: The part of aspirin depicted in these carbon atoms is: The central carbon has 3 electron groups and no lone pairs, which means it’s molecular geometry is trigonal planar.
Is sodium salicylate the same as aspirin?
Sodium salicylate is the “other” nonprescription salicylate. Its characteristics are similar to those of aspirin with one major exception: sodium salicylate is not acetylated. As such, it does not have a two-compartment half-life as does aspirin.
Is sodium salicylate aspirin?
Sodium salicylate, the active component of aspirin, is widely used for its antiinflammatory, antipyretic, and analgesic effects and also for its inhibitory effect on platelet aggregation.
What is aspirin C9H8O4?
Aspirin is a medicine that is very common. The molecular formula for Aspirin is C9H8O4. It has it has 9 carbon 8 hydrogen and 4 oxygen molecules. The Aspirin molecule is relevant to our world because this is use for pain,aches and fevers!
How is aspirin synthesized?
Aspirin is prepared by chemical synthesis from salicylic acid, through acetylation with acetic anhydride. The molecular weight of aspirin is 180.16g/mol. As a control mechanism, they act locally at the site of synthesis which limits the extent of their activity. They are also broken down rapidly by the body.
What is the molecular formula of aspirin sodium?
Aspirin sodium. PubChem CID. 23666729. Structure. Find Similar Structures. Molecular Formula. C9H7NaO4. Synonyms. Aspirin sodium.
What is the chemical formula for sea salt?
Related Questions More Answers Below. The chemical formula for sea salt is still NaCl, or sodium chloride, which is also called table salt. Sea salt is salt that just comes from the sea but it is still the same compound. This however varies with different salts in the sea. These salts include sodium chloride as afore mentioned,…
What is the 2D chemical structure image of aspirin?
The 2D chemical structure image of aspirin is also called skeletal formula, which is the standard notation for organic molecules.
What is the chemical composition of seawater?
These are mostly calcium, potassium, and magnesium salts of chloride and sulfate with substantially lesser amounts of many trace elements found in natural seawater. Though the composition of commercially available salt may vary, the ionic composition of natural saltwater is relatively constant.
0